![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | wisconsin/ | 2022-05-04 19:57 | - | |
![[DIR]](/icons/folder.gif) | waldo martin readings/ | 2022-05-04 19:57 | - | |
![[DIR]](/icons/folder.gif) | state of union videos/ | 2022-05-04 19:57 | - | |
![[DIR]](/icons/folder.gif) | register guard/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | pdf files/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | occupy wall street cartoons/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | newest from home/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | newest/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | movies/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | misc extra/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | jah articles in pdf/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | jah/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | images/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | docs and text/ | 2022-05-04 19:56 | - | |
![[DIR]](/icons/folder.gif) | wwii saved web images/ | 2015-05-04 20:35 | - | |
![[TXT]](/icons/text.gif) | wwi armenian genocide 2010.html | 2015-05-04 20:35 | 8.6K | |
![[IMG]](/icons/image2.gif) | wisconsin lafollette.jpg | 2015-05-04 20:35 | 24K | |
![[VID]](/icons/movie.gif) | Wyatt Cenac The N Word.mp4 | 2015-05-04 20:35 | 5.5M | |
![[TXT]](/icons/text.gif) | Women_Surpass_Men.html | 2015-05-04 20:35 | 1.5K | |
![[IMG]](/icons/image2.gif) | WWIHungerMap.jpg | 2015-05-04 20:35 | 44K | |
![[ ]](/icons/layout.gif) | » Black Farmer Mega-Settlement Clears Way for Discrimination Claims by Women, Hispanics - Big Government.pdf | 2015-05-04 20:35 | 3.9M | |
![[VID]](/icons/movie.gif) | wife_beating.mp4 | 2015-05-04 20:35 | 18M | |
![[ ]](/icons/layout.gif) | Who's to Blame for Union Woes Frederick Winslow Taylor.pdf | 2015-05-04 20:35 | 93K | |
![[ ]](/icons/layout.gif) | Who's the Bigot, Mr. Brown.pdf | 2015-05-04 20:35 | 82K | |
![[VID]](/icons/movie.gif) | What We Saw at the Stewart-Colbert Rally to Restore Sanity [www.keepvid.com].mp4 | 2015-05-04 20:35 | 27M | |
![[VID]](/icons/movie.gif) | What We Saw at the Stewart-Colbert Rally to Restore Sanity [www.keepvid.com](2).mp4 | 2015-05-04 20:35 | 122M | |
![[IMG]](/icons/image2.gif) | what has america become.jpg | 2015-05-04 20:35 | 79K | |
![[IMG]](/icons/image2.gif) | war presidents.jpeg | 2015-05-04 20:35 | 102K | |
![[IMG]](/icons/image2.gif) | voter_humor.png | 2015-05-04 20:35 | 111K | |
![[TXT]](/icons/text.gif) | votechooser.com.txt | 2015-05-04 20:35 | 20 | |
![[TXT]](/icons/text.gif) | us goes to mexico and makes demands.txt | 2015-05-04 20:35 | 70 | |
![[IMG]](/icons/image2.gif) | us frees countries.jpeg | 2015-05-04 20:35 | 39K | |
![[ ]](/icons/layout.gif) | unemployment and reelection.pdf | 2015-05-04 20:35 | 702K | |
![[TXT]](/icons/text.gif) | un_food_crisis.html | 2015-05-04 20:35 | 17K | |
![[IMG]](/icons/image2.gif) | tule lake internment.png | 2015-05-04 20:35 | 619K | |
![[ ]](/icons/layout.gif) | What Is It We Wish to Conserve2.pdf | 2015-05-04 20:35 | 114K | |
![[ ]](/icons/layout.gif) | What Is It We Wish to Conserve.pdf | 2015-05-04 20:35 | 116K | |
![[ ]](/icons/layout.gif) | Wall Street Protesters Half Right - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 91K | |
![[ ]](/icons/layout.gif) | Vulture capitalism - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 59K | |
![[ ]](/icons/layout.gif) | Voting for the National Interest, Not Self-Interest - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 98K | |
![[TXT]](/icons/text.gif) | Voting for the National Interest, Not Self-Interest - HUMAN EVENTS.html | 2015-05-04 20:35 | 9.8K | |
![[ ]](/icons/layout.gif) | Vietnam atrocities revealed in report - The Boston Globe.pdf | 2015-05-04 20:35 | 96K | |
![[ ]](/icons/layout.gif) | Uncivil Unions - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 122K | |
![[ ]](/icons/layout.gif) | US congressional committee approves resolution on Armenian genocide - South Eastern Europe - The Sofia Echo.pdf | 2015-05-04 20:35 | 81K | |
![[VID]](/icons/movie.gif) | USA whose version.wmv | 2015-05-04 20:35 | 4.3M | |
![[ ]](/icons/layout.gif) | Trust in government key to gains for liberals | Editorial | The Register-Guard | Eugene, Oregon.pdf | 2015-05-04 20:35 | 59K | |
![[VID]](/icons/movie.gif) | trigger_the_vote.mp4 | 2015-05-04 20:35 | 9.0M | |
![[VID]](/icons/movie.gif) | threat to free speech.mp4 | 2015-05-04 20:35 | 14M | |
![[IMG]](/icons/image2.gif) | the-internet.jpg | 2015-05-04 20:35 | 247K | |
![[ ]](/icons/layout.gif) | texas school board wrong education.pdf | 2015-05-04 20:35 | 72K | |
![[ ]](/icons/layout.gif) | Thomas Fleming Asks Whether George W. Bush Was the Worst President - WSJ.com.pdf | 2015-05-04 20:35 | 168K | |
![[ ]](/icons/unknown.gif) | Thinking history_ch1 | 2015-05-04 20:35 | 108K | |
![[ ]](/icons/layout.gif) | There Is No Male-Female Wage Gap - WSJ.com.pdf | 2015-05-04 20:35 | 302K | |
![[ ]](/icons/layout.gif) | The War Over America's Past - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 90K | |
![[VID]](/icons/movie.gif) | The Simpsons - Comments about PhDs and Grad Students. [HQ] [www.Keep-Tube.com].mp4 | 2015-05-04 20:35 | 2.7M | |
![[ ]](/icons/layout.gif) | The Register-Guard, Diversity Article.pdf | 2015-05-04 20:35 | 50K | |
![[ ]](/icons/layout.gif) | The New Intolerance - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 82K | |
![[ ]](/icons/layout.gif) | The Miracle of iCapitalism - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 94K | |
![[TXT]](/icons/text.gif) | The Irresponsible and Their Demands.html | 2015-05-04 20:35 | 12K | |
![[ ]](/icons/layout.gif) | The Irresponsible and Their Demands - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 97K | |
![[ ]](/icons/layout.gif) | The Coming Church-State Wars - HUMAN EVENTS 2.pdf | 2015-05-04 20:35 | 103K | |
![[ ]](/icons/layout.gif) | The Coming Church-State Wars - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 103K | |
![[ ]](/icons/unknown.gif) | THEGIANTAHAPREVIEW.doc | 2015-05-04 20:35 | 616K | |
![[ ]](/icons/layout.gif) | THE DEFINITION OF LIBERALISM.pdf | 2015-05-04 20:35 | 61K | |
![[VID]](/icons/movie.gif) | TEDxNYED - Henry Jenkins - 03_06_10 [www.keepvid.com].mp4 | 2015-05-04 20:35 | 62M | |
![[IMG]](/icons/image2.gif) | tax cuts chart.PNG | 2015-05-04 20:35 | 121K | |
![[ ]](/icons/layout.gif) | taking sides in the classroom.pdf | 2015-05-04 20:35 | 51K | |
![[TXT]](/icons/text.gif) | Tea Party's Winning Hand.html | 2015-05-04 20:35 | 11K | |
![[ ]](/icons/layout.gif) | Tea Party's Winning Hand - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 99K | |
![[ ]](/icons/layout.gif) | Taxing the Rich - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 73K | |
![[DIR]](/icons/folder.gif) | Taking Sides in the Classroom - Advice - The Chronicle of Higher Education_files/ | 2015-05-04 20:35 | - | |
![[ ]](/icons/layout.gif) | t-shirt sales at mall.pdf | 2015-05-04 20:35 | 56K | |
![[IMG]](/icons/image2.gif) | sup ct justices.png | 2015-05-04 20:35 | 134K | |
![[ ]](/icons/layout.gif) | straight-talk-about-plagiarism.pdf | 2015-05-04 20:35 | 24K | |
![[TXT]](/icons/text.gif) | stossel taxing right.html | 2015-05-04 20:35 | 36K | |
![[TXT]](/icons/text.gif) | Taking Sides in the Classroom - Advice - The Chronicle of Higher Education.html | 2015-05-04 20:35 | 111K | |
![[VID]](/icons/movie.gif) | SugataMitra_2010G-medium.flv | 2015-05-04 20:35 | 31M | |
![[VID]](/icons/movie.gif) | Story of Stuff, Full Version; How Things Work, About Stuff [www.Keep-Tube.com].mp4 | 2015-05-04 20:35 | 73M | |
![[IMG]](/icons/image2.gif) | stopthepresses-552046017-1295375553.jpg | 2015-05-04 20:35 | 20K | |
![[VID]](/icons/movie.gif) | Steven Pinker_ A brief history of violence [www.Keep-Tube.com].mp4 | 2015-05-04 20:35 | 93M | |
![[ ]](/icons/compressed.gif) | steve jobs memorial pics.zip | 2015-05-04 20:35 | 723K | |
![[IMG]](/icons/image2.gif) | StateCityHeader.jpg | 2015-05-04 20:35 | 66K | |
![[IMG]](/icons/image2.gif) | speeding.png | 2015-05-04 20:35 | 377K | |
![[TXT]](/icons/text.gif) | speech-court-animal-cruelty-free.html | 2015-05-04 20:35 | 5.5K | |
![[IMG]](/icons/image2.gif) | soldier knife in back.jpeg | 2015-05-04 20:35 | 37K | |
![[IMG]](/icons/image2.gif) | snuggies.png | 2015-05-04 20:35 | 128K | |
![[ ]](/icons/layout.gif) | single-women_outearn men.pdf | 2015-05-04 20:35 | 142K | |
![[IMG]](/icons/image2.gif) | sheneman00.gif | 2015-05-04 20:35 | 37K | |
![[SND]](/icons/sound2.gif) | secrets of wwii.mp3 | 2015-05-04 20:35 | 21M | |
![[TXT]](/icons/text.gif) | search_and_seizure_Sup_Ct.html | 2015-05-04 20:35 | 12K | |
![[ ]](/icons/layout.gif) | school tax loser.pdf | 2015-05-04 20:35 | 157K | |
![[ ]](/icons/layout.gif) | school days off.pdf | 2015-05-04 20:35 | 98K | |
![[ ]](/icons/layout.gif) | scalia-teaches-first-of-b_b_813633.pdf | 2015-05-04 20:35 | 61K | |
![[TXT]](/icons/text.gif) | scalia-teaches-first-of-b_b_813633.html | 2015-05-04 20:35 | 130K | |
![[IMG]](/icons/image2.gif) | sanger.jpg | 2015-05-04 20:35 | 29K | |
![[IMG]](/icons/image2.gif) | rosie and arizona.jpeg | 2015-05-04 20:35 | 51K | |
![[VID]](/icons/movie.gif) | restoration-of-star-spangled-banner-uncovers-horri-flv.mp4 | 2015-05-04 20:35 | 9.0M | |
![[IMG]](/icons/image2.gif) | reparations.png | 2015-05-04 20:35 | 440K | |
![[ ]](/icons/layout.gif) | rejection of obama - new deal progressives.pdf | 2015-05-04 20:35 | 72K | |
![[IMG]](/icons/image2.gif) | raise minimum wage.jpg | 2015-05-04 20:35 | 37K | |
![[TXT]](/icons/text.gif) | racism letter to editor 4-22-2010.txt | 2015-05-04 20:35 | 1.6K | |
![[ ]](/icons/layout.gif) | Stanford Magazine_ March_April 1999_ Don't Blame Hoover.pdf | 2015-05-04 20:35 | 579K | |
![[ ]](/icons/layout.gif) | Social Security, George W. Bush--And the "L" Word (No, Not Liberalism).pdf | 2015-05-04 20:35 | 1.0M | |
![[IMG]](/icons/image2.gif) | SmokersMural.jpg | 2015-05-04 20:35 | 43K | |
![[ ]](/icons/layout.gif) | Shirky_ A Group Is Its Own Worst Enemy.pdf | 2015-05-04 20:35 | 136K | |
![[ ]](/icons/layout.gif) | Shakedown in Copenhagen - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 84K | |
![[ ]](/icons/layout.gif) | Scrooge Was A Liberal - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 115K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-05 at 12.47.08 PM.png | 2015-05-04 20:35 | 200K | |
![[ ]](/icons/layout.gif) | Science Warriors Ego Trips.pdf | 2015-05-04 20:35 | 104K | |
![[IMG]](/icons/image2.gif) | S-CantHoldManDown.gif | 2015-05-04 20:35 | 5.2K | |
![[ ]](/icons/layout.gif) | Rampant Fraud Threat to China’s Brisk Ascent - NYTimes.com.pdf | 2015-05-04 20:35 | 125K | |
![[ ]](/icons/layout.gif) | Racist Past for Oregon.pdf | 2015-05-04 20:35 | 61K | |
![[VID]](/icons/movie.gif) | Quantitative Easing Simplified.mp4 | 2015-05-04 20:35 | 7.8M | |
![[IMG]](/icons/image2.gif) | putin.gif | 2015-05-04 20:35 | 32K | |
![[IMG]](/icons/image2.gif) | pro surge.jpeg | 2015-05-04 20:35 | 97K | |
![[TXT]](/icons/text.gif) | prosser slave revolt.html | 2015-05-04 20:35 | 13K | |
![[IMG]](/icons/image2.gif) | pro rep sticker.jpeg | 2015-05-04 20:35 | 13K | |
![[VID]](/icons/movie.gif) | presidents song.mp4 | 2015-05-04 20:35 | 9.3M | |
![[ ]](/icons/layout.gif) | presidential biographies.pdf | 2015-05-04 20:35 | 57K | |
![[IMG]](/icons/image2.gif) | premature-ejaculation.jpg | 2015-05-04 20:35 | 67K | |
![[TXT]](/icons/text.gif) | popular_vs_electoral.html | 2015-05-04 20:35 | 11K | |
![[IMG]](/icons/image2.gif) | political_matrix.gif | 2015-05-04 20:35 | 12K | |
![[TXT]](/icons/text.gif) | plant_rights.html | 2015-05-04 20:35 | 10K | |
![[IMG]](/icons/image2.gif) | pinnochio.jpeg | 2015-05-04 20:35 | 129K | |
![[VID]](/icons/movie.gif) | Quantitative Easing Explained.mp4 | 2015-05-04 20:35 | 13M | |
![[ ]](/icons/layout.gif) | Prohibitionists- Leave Us Alone.pdf | 2015-05-04 20:35 | 749K | |
![[ ]](/icons/layout.gif) | Print Story_ Texas board adopts new social studies curriculum - Yahoo! News.pdf | 2015-05-04 20:35 | 74K | |
![[ ]](/icons/layout.gif) | Print Story_ Senate Dems say jobless benefits bill on track - Yahoo! News.pdf | 2015-05-04 20:35 | 80K | |
![[ ]](/icons/layout.gif) | Print Story_ STIMULUS WATCH_ White House changes job-count rule - Yahoo! News.pdf | 2015-05-04 20:35 | 79K | |
![[ ]](/icons/layout.gif) | Print Story_ Report_ Castro says Cuban model doesn't work - Yahoo! News.pdf | 2015-05-04 20:35 | 77K | |
![[ ]](/icons/layout.gif) | Print Story_ Racist incidents, protests spread at UC campuses - Yahoo! News.pdf | 2015-05-04 20:35 | 76K | |
![[ ]](/icons/layout.gif) | Print Story_ Palin raises money for GOP in liberal Oregon town - Yahoo! News.pdf | 2015-05-04 20:35 | 74K | |
![[ ]](/icons/layout.gif) | Print Story_ Ohio GOP candidate defends Nazi re-enactments - Yahoo! News.pdf | 2015-05-04 20:35 | 74K | |
![[ ]](/icons/layout.gif) | Print Story_ Obama_ Money alone can't solve school predicament - Yahoo! News.pdf | 2015-05-04 20:35 | 80K | |
![[ ]](/icons/layout.gif) | Print Story_ CIA to release details on decades of secrets on Yahoo! News.pdf | 2015-05-04 20:35 | 46K | |
![[ ]](/icons/layout.gif) | Print Story_ Arizona gov. signs bill targeting ethnic studies - Yahoo! News.pdf | 2015-05-04 20:35 | 67K | |
![[ ]](/icons/layout.gif) | Print Story: On Civil War Anniversary, Confederate Group Stirs Debate - Yahoo! News.pdf | 2015-05-04 20:35 | 105K | |
![[ ]](/icons/layout.gif) | Print Story: Gas prices are about more than just oil - Yahoo! News.pdf | 2015-05-04 20:35 | 94K | |
![[ ]](/icons/layout.gif) | Print Story: Budget tricks helped Obama save programs from cuts - Yahoo! News.pdf | 2015-05-04 20:35 | 95K | |
![[ ]](/icons/layout.gif) | Print Story: 40 years after leak, Pentagon Papers are out - Yahoo! News.pdf | 2015-05-04 20:35 | 93K | |
![[VID]](/icons/movie.gif) | President Coolidge, 1st Presidential Film (1924) [www.keepvid.com].mp4 | 2015-05-04 20:35 | 18M | |
![[VID]](/icons/movie.gif) | President Bill Clinton Defends Byrd_s Ties With KKK [www.keepvid.com].mp4 | 2015-05-04 20:35 | 1.5M | |
![[ ]](/icons/layout.gif) | PROGRESSIVE_ Resistance to health care bill strong - Yahoo! News.pdf | 2015-05-04 20:35 | 693K | |
![[IMG]](/icons/image2.gif) | PJ_ORourke on liberals.png | 2015-05-04 20:35 | 60K | |
![[IMG]](/icons/image2.gif) | petraeus.gif | 2015-05-04 20:35 | 46K | |
![[TXT]](/icons/text.gif) | pessimism today.txt | 2015-05-04 20:35 | 1.0K | |
![[VID]](/icons/movie.gif) | outcast indians.mp4 | 2015-05-04 20:35 | 16M | |
![[ ]](/icons/layout.gif) | or state unions.pdf | 2015-05-04 20:35 | 127K | |
![[TXT]](/icons/text.gif) | opec_cartel_prices.html | 2015-05-04 20:35 | 24K | |
![[IMG]](/icons/image2.gif) | old_repub_new_dem.gif | 2015-05-04 20:35 | 48K | |
![[TXT]](/icons/text.gif) | obamas_problems.html | 2015-05-04 20:35 | 15K | |
![[TXT]](/icons/text.gif) | obama_infanticide.html | 2015-05-04 20:35 | 8.4K | |
![[IMG]](/icons/image2.gif) | obama_hillary.gif | 2015-05-04 20:35 | 100K | |
![[IMG]](/icons/image2.gif) | Picture 3.png | 2015-05-04 20:35 | 758K | |
![[IMG]](/icons/image2.gif) | Picture 2.png | 2015-05-04 20:35 | 727K | |
![[IMG]](/icons/image2.gif) | Picture 1.png | 2015-05-04 20:35 | 357K | |
![[ ]](/icons/layout.gif) | Phoenix Suns play politics.pdf | 2015-05-04 20:35 | 286K | |
![[IMG]](/icons/image2.gif) | People's History.jpg | 2015-05-04 20:35 | 20K | |
![[TXT]](/icons/text.gif) | Pentagon papers out.html | 2015-05-04 20:35 | 19K | |
![[IMG]](/icons/image2.gif) | PelosisPulpit.jpg | 2015-05-04 20:35 | 54K | |
![[ ]](/icons/layout.gif) | Pelosi Seeks Catholic Help on Immigration - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 386K | |
![[TXT]](/icons/text.gif) | Palin in LIberal townprint.html | 2015-05-04 20:35 | 13K | |
![[ ]](/icons/layout.gif) | Paladino Laces Speech With Antigay Remarks - NYTimes.com.pdf | 2015-05-04 20:35 | 1.0M | |
![[TXT]](/icons/text.gif) | Our Dangerous Attorney General.html | 2015-05-04 20:35 | 9.4K | |
![[ ]](/icons/layout.gif) | Our Dangerous Attorney General - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 439K | |
![[ ]](/icons/layout.gif) | Our Clueless Professor - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 91K | |
![[IMG]](/icons/image2.gif) | Opecrev.gif | 2015-05-04 20:35 | 7.2K | |
![[ ]](/icons/layout.gif) | On Civil War Anniversary, Confederate Group Stirs Debate -- Printout -- TIME.pdf | 2015-05-04 20:35 | 208K | |
![[TXT]](/icons/text.gif) | obama on school teachers.html | 2015-05-04 20:35 | 34K | |
![[TXT]](/icons/text.gif) | obama disclose donor list.html | 2015-05-04 20:35 | 11K | |
![[ ]](/icons/layout.gif) | obama at wisconsin liberal unemployment.pdf | 2015-05-04 20:35 | 49K | |
![[VID]](/icons/movie.gif) | obama-drastically-scales-back-goals-for-america-af-flv.mp4 | 2015-05-04 20:35 | 10M | |
![[IMG]](/icons/image2.gif) | obama & fox.gif | 2015-05-04 20:35 | 29K | |
![[SND]](/icons/sound2.gif) | npr_pj_orourke.mp3 | 2015-05-04 20:35 | 3.2M | |
![[ ]](/icons/layout.gif) | no wage gap.pdf | 2015-05-04 20:35 | 82K | |
![[TXT]](/icons/text.gif) | no_wage_gap.html | 2015-05-04 20:35 | 184K | |
![[TXT]](/icons/text.gif) | newt_drill_now.html | 2015-05-04 20:35 | 16K | |
![[ ]](/icons/layout.gif) | Obama disclose list campaign donors.pdf | 2015-05-04 20:35 | 107K | |
![[ ]](/icons/layout.gif) | Obama's remaking of America - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 64K | |
![[ ]](/icons/layout.gif) | Obama's War - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 100K | |
![[ ]](/icons/layout.gif) | Obama's Choice_ FDR or Reagan - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 74K | |
![[VID]](/icons/movie.gif) | No Pressure.mp4 | 2015-05-04 20:35 | 15M | |
![[ ]](/icons/layout.gif) | Newsmax - Left Soviet Dupes.pdf | 2015-05-04 20:35 | 67K | |
![[VID]](/icons/movie.gif) | NewRepublicanad.wmv | 2015-05-04 20:35 | 10M | |
![[ ]](/icons/layout.gif) | NYT hmong in laos 2007 .pdf | 2015-05-04 20:35 | 68K | |
![[IMG]](/icons/image2.gif) | n13801964_33128480_5711.jpg | 2015-05-04 20:35 | 34K | |
![[ ]](/icons/layout.gif) | myths about Lincoln.pdf | 2015-05-04 20:35 | 78K | |
![[ ]](/icons/layout.gif) | Nearly half of US households escape fed income tax - Yahoo! News.pdf | 2015-05-04 20:35 | 82K | |
![[TXT]](/icons/text.gif) | Nearly half avoid income tax.html | 2015-05-04 20:35 | 19K | |
![[VID]](/icons/movie.gif) | Multiculturalisme et islam en France reportage de CBN [www.Keep-Tube.com].mp4 | 2015-05-04 20:35 | 22M | |
![[TXT]](/icons/text.gif) | mistake_obama_auschwitz.html | 2015-05-04 20:35 | 13K | |
![[DIR]](/icons/folder.gif) | misc pictures 2011/ | 2015-05-04 20:35 | - | |
![[ ]](/icons/layout.gif) | Moral Politics: How Liberals and Conservatives Think, by George Lakoff, an excerpt.pdf | 2015-05-04 20:35 | 90K | |
![[ ]](/icons/layout.gif) | Mojave cross at center of court fight reported stolen - CNN.com.pdf | 2015-05-04 20:35 | 128K | |
![[ ]](/icons/layout.gif) | Mojave 2 cross at center of court fight reported stolen - CNN.com.pdf | 2015-05-04 20:35 | 662K | |
![[ ]](/icons/layout.gif) | Modern Civil Rights_ Cockfighting & Same-Sex Proms - HUMAN EVENTS.pdf | 2015-05-04 20:35 | 98K | |
![[IMG]](/icons/image2.gif) | minimum_wage_cartoon.gif | 2015-05-04 20:34 | 36K | |
![[ ]](/icons/layout.gif) | michell Rhee in WashDC.pdf | 2015-05-04 20:34 | 226K | |
![[IMG]](/icons/image2.gif) | mdarizona.jpg | 2015-05-04 20:34 | 180K | |
![[IMG]](/icons/image2.gif) | mccartin_fig04b.jpg | 2015-05-04 20:34 | 44K | |
![[TXT]](/icons/text.gif) | mccain_beating_obama__left_and_right.html | 2015-05-04 20:34 | 19K | |
![[DIR]](/icons/folder.gif) | mascots/ | 2015-05-04 20:34 | - | |
![[ ]](/icons/layout.gif) | marriage.pdf | 2015-05-04 20:34 | 532K | |
![[IMG]](/icons/image2.gif) | lrch2007-08-14-1187122635.gif | 2015-05-04 20:34 | 3.1K | |
![[TXT]](/icons/text.gif) | lower simpler taxes.html | 2015-05-04 20:34 | 9.8K | |
![[TXT]](/icons/text.gif) | look whos nativist now.html | 2015-05-04 20:34 | 11K | |
![[TXT]](/icons/text.gif) | loewen_interview.html | 2015-05-04 20:34 | 18K | |
![[IMG]](/icons/image2.gif) | loan_administrators.png | 2015-05-04 20:34 | 410K | |
![[IMG]](/icons/image2.gif) | loan.jpg | 2015-05-04 20:34 | 38K | |
![[ ]](/icons/layout.gif) | Michelle Rhee's Cheating Scandal.pdf | 2015-05-04 20:34 | 96K | |
![[ ]](/icons/layout.gif) | Merit Pay NEA.pdf | 2015-05-04 20:34 | 44K | |
![[IMG]](/icons/image2.gif) | McDonalds.jpg | 2015-05-04 20:34 | 61K | |
![[ ]](/icons/layout.gif) | Lower & Simplify Taxes! - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 76K | |
![[ ]](/icons/unknown.gif) | Love the sinner.doc | 2015-05-04 20:34 | 21K | |
![[ ]](/icons/layout.gif) | Look Who's 'Nativist' Now! - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 113K | |
![[TXT]](/icons/text.gif) | letter to editor rg cell phones.txt | 2015-05-04 20:34 | 1.5K | |
![[ ]](/icons/layout.gif) | letters to editor 4-22-2010.pdf | 2015-05-04 20:34 | 165K | |
![[IMG]](/icons/image2.gif) | last wwi vet.jpg | 2015-05-04 20:34 | 770K | |
![[VID]](/icons/movie.gif) | kim jong il ashes.mp4 | 2015-05-04 20:34 | 67M | |
![[VID]](/icons/movie.gif) | Lin-Manuel Miranda Performs at the White House Poetry Jam_ (8 of 8) [www.keepvid.com].mp4 | 2015-05-04 20:34 | 18M | |
![[ ]](/icons/layout.gif) | Like Sarah Palin, Early Feminists Were Pro-Life - Letters and Comments (usnews.com).pdf | 2015-05-04 20:34 | 122K | |
![[ ]](/icons/layout.gif) | Liberal Seek Ban on Metaphors In Wake of Arizona Shooting - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 118K | |
![[TXT]](/icons/text.gif) | L-liberalism.htm | 2015-05-04 20:34 | 12K | |
![[IMG]](/icons/image2.gif) | kagan.jpg | 2015-05-04 20:34 | 38K | |
![[VID]](/icons/movie.gif) | Kelly Hu on Doe v. Kamehameha [www.Keep-Tube.com].mp4 | 2015-05-04 20:34 | 14M | |
![[ ]](/icons/layout.gif) | Justices skip Obama 2011 speech.pdf | 2015-05-04 20:34 | 128K | |
![[VID]](/icons/movie.gif) | JonathanHaidt_2008-medium.flv | 2015-05-04 20:34 | 33M | |
![[TXT]](/icons/text.gif) | jobless benefits.html | 2015-05-04 20:34 | 15K | |
![[IMG]](/icons/image2.gif) | japrathuntinglicense.jpg | 2015-05-04 20:34 | 38K | |
![[ ]](/icons/layout.gif) | Jerome Garger.pdf | 2015-05-04 20:34 | 54K | |
![[VID]](/icons/movie.gif) | Jena - John Mellencamp Music Video [www.Keep-Tube.com].mp4 | 2015-05-04 20:34 | 17M | |
![[IMG]](/icons/image2.gif) | islam dooms.jpeg | 2015-05-04 20:34 | 85K | |
![[TXT]](/icons/text.gif) | is_marriage_a_civil_right.htm | 2015-05-04 20:34 | 9.0K | |
![[IMG]](/icons/image2.gif) | iran_venezuela.png | 2015-05-04 20:34 | 418K | |
![[IMG]](/icons/image2.gif) | internetcensorship.gif | 2015-05-04 20:34 | 42K | |
![[TXT]](/icons/text.gif) | intelligent_design_article.htm | 2015-05-04 20:34 | 268 | |
![[IMG]](/icons/image2.gif) | immigration_graph_percentages.png | 2015-05-04 20:34 | 122K | |
![[IMG]](/icons/image2.gif) | immigration_graph.png | 2015-05-04 20:34 | 122K | |
![[DIR]](/icons/folder.gif) | immigration/ | 2015-05-04 20:34 | - | |
![[TXT]](/icons/text.gif) | Is same-sex marriage a civil rights issue?.html | 2015-05-04 20:34 | 51K | |
![[IMG]](/icons/image2.gif) | Islamic-Ammunition.gif | 2015-05-04 20:34 | 141K | |
![[TXT]](/icons/text.gif) | Iraq_facts.txt | 2015-05-04 20:34 | 7.7K | |
![[VID]](/icons/movie.gif) | Income Tax Propaganda Cartoon [www.keepvid.com].mp4 | 2015-05-04 20:34 | 16M | |
![[IMG]](/icons/image2.gif) | IMG_0035.PNG | 2015-05-04 20:34 | 121K | |
![[ ]](/icons/unknown.gif) | illegal alien status.rtf | 2015-05-04 20:34 | 5.2K | |
![[TXT]](/icons/text.gif) | ignoring_opec.html | 2015-05-04 20:34 | 30K | |
![[DIR]](/icons/folder.gif) | html pages/ | 2015-05-04 20:34 | - | |
![[IMG]](/icons/image2.gif) | ht_reagan_rushmore_jef_110204_mn.jpg | 2015-05-04 20:34 | 24K | |
![[IMG]](/icons/image2.gif) | holocaust_reminder.jpg | 2015-05-04 20:34 | 202K | |
![[DIR]](/icons/folder.gif) | hippie book/ | 2015-05-04 20:34 | - | |
![[IMG]](/icons/image2.gif) | hilary in jail.jpeg | 2015-05-04 20:34 | 54K | |
![[TXT]](/icons/text.gif) | higher_standards.html | 2015-05-04 20:34 | 28K | |
![[IMG]](/icons/image2.gif) | heston.png | 2015-05-04 20:34 | 298K | |
![[IMG]](/icons/image2.gif) | henryVIII.jpg | 2015-05-04 20:34 | 45K | |
![[TXT]](/icons/text.gif) | health_care_young_adults.html | 2015-05-04 20:34 | 19K | |
![[ ]](/icons/layout.gif) | hawking on the beginning.pdf | 2015-05-04 20:34 | 70K | |
![[VID]](/icons/movie.gif) | hate your job.mov | 2015-05-04 20:34 | 3.5M | |
![[IMG]](/icons/image2.gif) | gty_moammar_gadhafi_cellphone_2_dm_111020_wg.jpg | 2015-05-04 20:34 | 79K | |
![[VID]](/icons/movie.gif) | green police.mp4 | 2015-05-04 20:34 | 15M | |
![[ ]](/icons/layout.gif) | I Sure Hope Rita Wilson Isn’t A Math Teacher | RedState.pdf | 2015-05-04 20:34 | 145K | |
![[ ]](/icons/layout.gif) | Historians question White House presidential bios - Yahoo! News.pdf | 2015-05-04 20:34 | 99K | |
![[ ]](/icons/layout.gif) | Hillsdale College - Imprimis Issue.pdf | 2015-05-04 20:34 | 124K | |
![[ ]](/icons/layout.gif) | Head Start Racked by Failure and Fraud - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 89K | |
![[ ]](/icons/layout.gif) | Harry Reid’s Negro Problem - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 100K | |
![[ ]](/icons/layout.gif) | HST195_ Photos show US soldiers posing with Afghan corpses - Yahoo! News.pdf | 2015-05-04 20:34 | 79K | |
![[IMG]](/icons/image2.gif) | graph jam wwii.png | 2015-05-04 20:34 | 46K | |
![[TXT]](/icons/text.gif) | global warming fascists.html | 2015-05-04 20:34 | 36K | |
![[IMG]](/icons/image2.gif) | germ warfare.gif | 2015-05-04 20:34 | 11K | |
![[TXT]](/icons/text.gif) | gay_marriage.html | 2015-05-04 20:34 | 11K | |
![[IMG]](/icons/image2.gif) | gas prices 2008-12.gif | 2015-05-04 20:34 | 18K | |
![[IMG]](/icons/image2.gif) | gabrielprosserpict.jpg | 2015-05-04 20:34 | 130K | |
![[ ]](/icons/layout.gif) | Govt_report_war_casualties.pdf | 2015-05-04 20:34 | 164K | |
![[ ]](/icons/layout.gif) | Going "Green" - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 82K | |
![[IMG]](/icons/image2.gif) | God's Billboard.gif | 2015-05-04 20:34 | 81K | |
![[ ]](/icons/layout.gif) | free speech animal cruelty.pdf | 2015-05-04 20:34 | 123K | |
![[VID]](/icons/movie.gif) | From Washington to Obama in Less Than 4 Minutes [www.Keep-Tube.com].mp4 | 2015-05-04 20:34 | 18M | |
![[VID]](/icons/movie.gif) | From George Washington To Barack Obama - A Long Way - Original Video [www.Keep-Tube.com].mp4 | 2015-05-04 20:34 | 14M | |
![[VID]](/icons/movie.gif) | Forgotten Man.mp4 | 2015-05-04 20:34 | 31M | |
![[TXT]](/icons/text.gif) | fleming on wilson and wwi.txt | 2015-05-04 20:34 | 1.5K | |
![[TXT]](/icons/text.gif) | first day notes.txt | 2015-05-04 20:34 | 649 | |
![[ ]](/icons/layout.gif) | fighting sioux ND mascot logo banned 2010.pdf | 2015-05-04 20:34 | 46K | |
![[ ]](/icons/layout.gif) | federalindividualratehistory-20080107.pdf | 2015-05-04 20:34 | 269K | |
![[ ]](/icons/layout.gif) | fatherless households.pdf | 2015-05-04 20:34 | 102K | |
![[TXT]](/icons/text.gif) | fatherless.html | 2015-05-04 20:34 | 6.9K | |
![[ ]](/icons/layout.gif) | exposed revisionist history conference.pdf | 2015-05-04 20:34 | 79K | |
![[IMG]](/icons/image2.gif) | evolution-of-nfl-protective-gear.jpg | 2015-05-04 20:34 | 614K | |
![[ ]](/icons/layout.gif) | eisenhower farewell address new drafts.pdf | 2015-05-04 20:34 | 94K | |
![[TXT]](/icons/text.gif) | eisenhower_nukes copy.html | 2015-05-04 20:34 | 14K | |
![[TXT]](/icons/text.gif) | eisenhower_nukes.html | 2015-05-04 20:34 | 14K | |
![[IMG]](/icons/image2.gif) | edwards_blog.gif | 2015-05-04 20:34 | 25K | |
![[VID]](/icons/movie.gif) | Forgotten Man LOW.mp4 | 2015-05-04 20:34 | 12M | |
![[TXT]](/icons/text.gif) | Fleming on worst Bush.html | 2015-05-04 20:34 | 138K | |
![[TXT]](/icons/text.gif) | Federal_Goverment_Fraud.html | 2015-05-04 20:34 | 18K | |
![[ ]](/icons/layout.gif) | End the Drug War, Save Black America - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 86K | |
![[IMG]](/icons/image2.gif) | Elizabeth_Cady_Stanton_and_Susan_B._Anthony.jpg | 2015-05-04 20:34 | 46K | |
![[ ]](/icons/unknown.gif) | EMPIRE17.swf | 2015-05-04 20:34 | 1.1M | |
![[DIR]](/icons/folder.gif) | educ videos/ | 2015-05-04 20:34 | - | |
![[IMG]](/icons/image2.gif) | e110304_Handelsmanpg-vertical.jpg | 2015-05-04 20:34 | 35K | |
![[TXT]](/icons/text.gif) | drill_for_oil_please.html | 2015-05-04 20:34 | 8.3K | |
![[IMG]](/icons/image2.gif) | dont-ask-dont-tell-don-t-enlist-political-poster-1265560974.jpg | 2015-05-04 20:34 | 56K | |
![[ ]](/icons/layout.gif) | don't know much with david mccullough.pdf | 2015-05-04 20:34 | 99K | |
![[TXT]](/icons/text.gif) | dinner bill.htm | 2015-05-04 20:34 | 15K | |
![[IMG]](/icons/image2.gif) | dem subsidies.jpeg | 2015-05-04 20:34 | 75K | |
![[TXT]](/icons/text.gif) | democrats_pursue_faith_vote.html | 2015-05-04 20:34 | 16K | |
![[TXT]](/icons/text.gif) | democrats_faith_vote.html | 2015-05-04 20:34 | 16K | |
![[IMG]](/icons/image2.gif) | dead soldiers.jpeg | 2015-05-04 20:34 | 92K | |
![[IMG]](/icons/image2.gif) | darwin fish.jpeg | 2015-05-04 20:34 | 17K | |
![[TXT]](/icons/text.gif) | danish_alqaida_bomb.html | 2015-05-04 20:34 | 18K | |
![[DIR]](/icons/folder.gif) | current cartoons/ | 2015-05-04 20:34 | - | |
![[IMG]](/icons/image2.gif) | crowson.jpg | 2015-05-04 20:34 | 66K | |
![[IMG]](/icons/image2.gif) | crowe.jpg | 2015-05-04 20:34 | 35K | |
![[TXT]](/icons/text.gif) | coulter scrooge was a liberal.html | 2015-05-04 20:34 | 11K | |
![[TXT]](/icons/text.gif) | coulter_obama_appeasement.html | 2015-05-04 20:34 | 10K | |
![[TXT]](/icons/text.gif) | coulter Uncivil Unions.html | 2015-05-04 20:34 | 10K | |
![[ ]](/icons/unknown.gif) | conservative - immigrants.rtf | 2015-05-04 20:34 | 5.3K | |
![[ ]](/icons/layout.gif) | congress in football.pdf | 2015-05-04 20:34 | 194K | |
![[TXT]](/icons/text.gif) | confederats stir up debate.html | 2015-05-04 20:34 | 22K | |
![[VID]](/icons/movie.gif) | communist dupes leftists.mp4 | 2015-05-04 20:34 | 73M | |
![[ ]](/icons/layout.gif) | Easily Understood Explanation of Derivative Markets (In plain language, even a drunk can understand)”.pdf | 2015-05-04 20:34 | 108K | |
![[ ]](/icons/layout.gif) | Does Teach for America Work?.pdf | 2015-05-04 20:34 | 99K | |
![[ ]](/icons/layout.gif) | Dancing to Big Labor's Tune - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 82K | |
![[IMG]](/icons/image2.gif) | DOJ.jpg | 2015-05-04 20:34 | 65K | |
![[ ]](/icons/layout.gif) | Critical Thinking Trusting the President.pdf | 2015-05-04 20:34 | 117K | |
![[ ]](/icons/layout.gif) | Crisis of the Government Party - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 83K | |
![[ ]](/icons/layout.gif) | Coulter on Unions forum 2 week 3.pdf | 2015-05-04 20:34 | 110K | |
![[TXT]](/icons/text.gif) | Coulter_Unions_forum2 week 3.html | 2015-05-04 20:34 | 10K | |
![[ ]](/icons/layout.gif) | Costs of the Occupiers - HUMAN EVENTS.pdf | 2015-05-04 20:34 | 100K | |
![[ ]](/icons/unknown.gif) | Conservative - being drugged.rtf | 2015-05-04 20:34 | 2.5K | |
![[TXT]](/icons/text.gif) | comments about abortion.txt | 2015-05-04 20:34 | 3.1K | |
![[ ]](/icons/layout.gif) | cleveland_booker_t.pdf | 2015-05-04 20:34 | 35K | |
![[ ]](/icons/layout.gif) | cath prot arguments.pdf | 2015-05-04 20:34 | 149K | |
![[VID]](/icons/movie.gif) | catholic vote 2012.mp4 | 2015-05-04 20:34 | 27M | |
![[IMG]](/icons/image2.gif) | capt.cps.moh87.290508041841.photo02.photo.default-512x327.jpg | 2015-05-04 20:34 | 65K | |
![[IMG]](/icons/image2.gif) | capt.cps.moh87.290508041841.photo00.photo.default-512x357.jpg | 2015-05-04 20:34 | 81K | |
![[IMG]](/icons/image2.gif) | capt.931f397e75ac447f81ef389207568200-35c224e267a949638bc1bea7242cd058-0.jpg | 2015-05-04 20:34 | 35K | |
![[TXT]](/icons/text.gif) | canadian health care.txt | 2015-05-04 20:34 | 4.8K | |
![[VID]](/icons/movie.gif) | bush second term.mp4 | 2015-05-04 20:34 | 9.7M | |
![[VID]](/icons/movie.gif) | Chinese Professor [www.Keep-Tube.com].mp4 | 2015-05-04 20:34 | 4.2M | |
![[ ]](/icons/layout.gif) | China Rejects Japan Apology.pdf | 2015-05-04 20:34 | 324K | |
![[TXT]](/icons/text.gif) | Charity_right_left.htm | 2015-05-04 20:34 | 23K | |
![[ ]](/icons/layout.gif) | Capitol Visitor Center Left Leaning.pdf | 2015-05-04 20:34 | 228K | |
![[ ]](/icons/layout.gif) | Can Japan Rise Again.pdf | 2015-05-04 20:34 | 100K | |
![[TXT]](/icons/text.gif) | bush libertarians.txt | 2015-05-04 20:34 | 7.5K | |
![[TXT]](/icons/text.gif) | bush libertarians.html | 2015-05-04 20:34 | 27K | |
![[TXT]](/icons/text.gif) | buchanon on the ayatollahs.html | 2015-05-04 20:34 | 11K | |
![[TXT]](/icons/text.gif) | buchanon on iran protesters HISTORY.html | 2015-05-04 20:34 | 11K | |
![[TXT]](/icons/text.gif) | buchanon new tribe rising.html | 2015-05-04 20:34 | 13K | |
![[ ]](/icons/layout.gif) | buchanon dumbing down america.pdf | 2015-05-04 20:34 | 49K | |
![[TXT]](/icons/text.gif) | buchanon clueless professor.html | 2015-05-04 20:34 | 9.9K | |
![[TXT]](/icons/text.gif) | buchanon civil war.html | 2015-05-04 20:34 | 11K | |
![[TXT]](/icons/text.gif) | buchanon bigot mr brown.html | 2015-05-04 20:34 | 13K | |
![[TXT]](/icons/text.gif) | buchanon_on_obama.html | 2015-05-04 20:34 | 11K | |
![[TXT]](/icons/text.gif) | buchanon_appeasement.html | 2015-05-04 20:34 | 11K | |
![[ ]](/icons/layout.gif) | buchanon New Tribe Rising.pdf | 2015-05-04 20:34 | 82K | |
![[ ]](/icons/layout.gif) | booker_t.pdf | 2015-05-04 20:34 | 319K | |
![[IMG]](/icons/image2.gif) | blank map.png | 2015-05-04 20:34 | 52K | |
![[ ]](/icons/layout.gif) | black republicans hope safari.pdf | 2015-05-04 20:34 | 46K | |
![[VID]](/icons/movie.gif) | barack obama.mp4 | 2015-05-04 20:34 | 14M | |
![[ ]](/icons/layout.gif) | ban_rap_lyrics.pdf | 2015-05-04 20:34 | 43K | |
![[IMG]](/icons/image2.gif) | bamatoon.jpg | 2015-05-04 20:34 | 33K | |
![[TXT]](/icons/text.gif) | bad_stats_register_guard_taxes.html | 2015-05-04 20:34 | 7.0K | |
![[IMG]](/icons/image2.gif) | awomansplace.gif | 2015-05-04 20:34 | 34K | |
![[ ]](/icons/layout.gif) | asian_racism_prank.pdf | 2015-05-04 20:34 | 40K | |
![[TXT]](/icons/text.gif) | appeasement_coulter.html | 2015-05-04 20:34 | 12K | |
![[IMG]](/icons/image2.gif) | apologies.jpeg | 2015-05-04 20:34 | 50K | |
![[IMG]](/icons/image2.gif) | ap_polls_graphic_gainsshort.jpg | 2015-05-04 20:34 | 14K | |
![[IMG]](/icons/image2.gif) | anti reid.jpeg | 2015-05-04 20:34 | 64K | |
![[IMG]](/icons/image2.gif) | anti islam.jpeg | 2015-05-04 20:34 | 20K | |
![[IMG]](/icons/image2.gif) | anti iran.jpeg | 2015-05-04 20:34 | 138K | |
![[IMG]](/icons/image2.gif) | anti dem vietnam.jpeg | 2015-05-04 20:34 | 66K | |
![[IMG]](/icons/image2.gif) | anti carter.jpeg | 2015-05-04 20:34 | 141K | |
![[IMG]](/icons/image2.gif) | anti_clinton.jpg | 2015-05-04 20:34 | 36K | |
![[IMG]](/icons/image2.gif) | anti_ceo_neocon.gif | 2015-05-04 20:34 | 25K | |
![[VID]](/icons/movie.gif) | anti_catholic.mp4 | 2015-05-04 20:34 | 24M | |
![[TXT]](/icons/text.gif) | anti-liberal.html | 2015-05-04 20:34 | 11K | |
![[IMG]](/icons/image2.gif) | ann_coulter_talking_doll.jpg | 2015-05-04 20:34 | 97K | |
![[TXT]](/icons/text.gif) | Buchanon Obamas Wararticle.php.html | 2015-05-04 20:34 | 11K | |
![[ ]](/icons/layout.gif) | Brazil Mothers.pdf | 2015-05-04 20:34 | 712K | |
![[ ]](/icons/layout.gif) | Black Republicans offer hope after Barack Obama's failures on race - Telegraph.pdf | 2015-05-04 20:34 | 499K | |
![[ ]](/icons/layout.gif) | Black Farmer Mega-Settlement Clears Way for Discrimination Claims by Women, Hispanics - FoxNews.com.pdf | 2015-05-04 20:34 | 153K | |
![[ ]](/icons/layout.gif) | Bible quote for seniors.pdf | 2015-05-04 20:34 | 99K | |
![[ ]](/icons/layout.gif) | BBC News - Who, What, Why: How many soldiers died in the US Civil War.pdf | 2015-05-04 20:34 | 170K | |
![[ ]](/icons/layout.gif) | Arizona shooting: America's elite hijacked massacre to take revenge on Sarah Palin | Mail Online.pdf | 2015-05-04 20:34 | 1.5M | |
![[VID]](/icons/movie.gif) | Ann Coulter_ Democrats the Party of Racists [www.Keep-Tube.com].mp4 | 2015-05-04 20:34 | 18M | |
![[VID]](/icons/movie.gif) | Animaniacs - Presidents [www.Keep-Tube.com].mp4 | 2015-05-04 20:34 | 9.3M | |
![[IMG]](/icons/image2.gif) | ATT916383.jpg | 2015-05-04 20:34 | 41K | |
![[IMG]](/icons/image2.gif) | americas crisis.jpg | 2015-05-04 20:34 | 235K | |
![[TXT]](/icons/text.gif) | amer history 101.txt | 2015-05-04 20:34 | 13K | |
![[ ]](/icons/layout.gif) | all_JAH_articles.pdf | 2015-05-04 20:34 | 707K | |
![[ ]](/icons/layout.gif) | airport security and muslims.pdf | 2015-05-04 20:34 | 111K | |
![[IMG]](/icons/image2.gif) | absolut1.png | 2015-05-04 20:34 | 300K | |
![[IMG]](/icons/image2.gif) | absolut.png | 2015-05-04 20:34 | 365K | |
![[ ]](/icons/layout.gif) | abortion_mexico.pdf | 2015-05-04 20:34 | 38K | |
![[VID]](/icons/movie.gif) | aMichael Jackson-Black or White-Official Music Video (With Lyrics) [www.keepvid.com].mp4 | 2015-05-04 20:34 | 16M | |
![[ ]](/icons/layout.gif) | American Thinker- Elian Gonzalez in Cuba.pdf | 2015-05-04 20:34 | 90K | |
![[TXT]](/icons/text.gif) | American Thinker- Elian Gonzalez in Cuba.html | 2015-05-04 20:34 | 7.7K | |
![[ ]](/icons/layout.gif) | American Catholics and the Intellectual Life.pdf | 2015-05-04 20:34 | 2.1M | |
![[ ]](/icons/layout.gif) | America's True History of Religious Tolerance .pdf | 2015-05-04 20:34 | 85K | |
![[VID]](/icons/movie.gif) | All of the Presidents...in under two minutes! [www.Keep-Tube.com].mp4 | 2015-05-04 20:34 | 4.0M | |
![[ ]](/icons/layout.gif) | Albert Haynesworth_ I am not a slave - Shutdown Corner - NFL - Yahoo! Sports.pdf | 2015-05-04 20:34 | 1.2M | |
![[ ]](/icons/layout.gif) | A Rum Battle, a Tax Hangover - NYTimes.com.pdf | 2015-05-04 20:34 | 93K | |
![[VID]](/icons/movie.gif) | 8_moore_poor_reasoning.mov | 2015-05-04 20:34 | 31M | |
![[VID]](/icons/movie.gif) | 8807be8dc5c535b5f8648dbd024af1c9.mp4 | 2015-05-04 20:34 | 22M | |
![[TXT]](/icons/text.gif) | 2008_electoral_contest.html | 2015-05-04 20:34 | 20K | |
![[IMG]](/icons/image2.gif) | 2008_06_04t124626_322x450_us_marriage_gays.jpg | 2015-05-04 20:34 | 66K | |
![[SND]](/icons/sound2.gif) | 2008_0519_Academic_Freedom_Horowitz_Nelson.mp3 | 2015-05-04 20:34 | 56M | |
![[IMG]](/icons/image2.gif) | 800px-Oil_Prices_1861_2007.svg.png | 2015-05-04 20:34 | 42K | |
![[IMG]](/icons/image2.gif) | 800px-NastRepublicanElephant.jpg | 2015-05-04 20:34 | 289K | |
![[IMG]](/icons/image2.gif) | 800px-Electoral_map.svg.png | 2015-05-04 20:34 | 142K | |
![[IMG]](/icons/image2.gif) | 535px-Militarist.JPG | 2015-05-04 20:34 | 69K | |
![[IMG]](/icons/image2.gif) | 488px-Old-friend.JPG | 2015-05-04 20:34 | 78K | |
![[IMG]](/icons/image2.gif) | 418Oz0SkY4L._SL500_AA300_.jpg | 2015-05-04 20:34 | 12K | |
![[IMG]](/icons/image2.gif) | 350px-SPIN.JPG | 2015-05-04 20:34 | 63K | |
![[IMG]](/icons/image2.gif) | 340x_kagansoftball.jpg | 2015-05-04 20:34 | 89K | |
![[IMG]](/icons/image2.gif) | 225px-Carrie_Chapman_Catt.jpg | 2015-05-04 20:34 | 12K | |
![[IMG]](/icons/image2.gif) | 41vDFbCnLyL._SL500_AA300_.jpg | 2015-05-04 20:34 | 12K | |
![[IMG]](/icons/image2.gif) | 41v-w5y-WsL._SL500_AA300_.gif.jpeg | 2015-05-04 20:34 | 12K | |
![[IMG]](/icons/image2.gif) | 8-villains4.jpg | 2015-05-04 20:34 | 1.6M | |
![[IMG]](/icons/image2.gif) | 5 gas.gif | 2015-05-04 20:34 | 71K | |
![[TXT]](/icons/text.gif) | 4-22-2010 letters to editor.html | 2015-05-04 20:34 | 11K | |
![[TXT]](/icons/text.gif) | 3rd party candidates.txt | 2015-05-04 20:34 | 483 | |
![[IMG]](/icons/image2.gif) | 2004.svg.png | 2015-05-04 19:51 | 106K | |
![[TXT]](/icons/text.gif) | 2001_anti_Rep_on_campus.html | 2015-05-04 19:51 | 16K | |
![[TXT]](/icons/text.gif) | 2000_gay_vote.html | 2015-05-04 19:51 | 13K | |
![[IMG]](/icons/image2.gif) | 2000.svg.png | 2015-05-04 19:51 | 106K | |
![[ ]](/icons/layout.gif) | 1972 newspaper mining vietnam ports.pdf | 2015-05-04 19:51 | 26M | |
![[IMG]](/icons/image2.gif) | 2-19-2011House-ABsliced_24.jpg | 2015-05-04 19:51 | 87K | |
![[IMG]](/icons/image2.gif) | 11072010Siers.slideshow_main.prod_affiliate.91.jpg | 2015-05-04 19:51 | 124K | |
![[VID]](/icons/movie.gif) | 18ceff7851009ab1d9a1213898ff3b6b.mp4 | 2015-05-04 19:51 | 7.5M | |
![[ ]](/icons/layout.gif) | 10 war photographs.pdf | 2015-05-04 19:51 | 1.0M | |
![[ ]](/icons/layout.gif) | 10th amendment cult - tenthers.pdf | 2015-05-04 19:51 | 85K | |
![[ ]](/icons/layout.gif) | 10 War Photographs That Changed the World Forever.pdf | 2015-05-04 19:51 | 3.5M | |
![[IMG]](/icons/image2.gif) | 0630-biz-MILK-web.gif | 2015-05-04 19:51 | 38K | |
![[ ]](/icons/layout.gif) | 'Bibi' Votes Republican - HUMAN EVENTS.pdf | 2015-05-04 19:51 | 96K | |
|